CAS 118000-64-9 is the registry number for 4-(6-Chloroimidazo[1,2-a]pyridin-2-yl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzonitrile (CAS 118000-64-9) is a chemical compound with the molecular formula C14H8ClN3 and a molecular weight of 253.68 g/mol. IUPAC name: 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzonitrile. InChIKey: AHKKVQQCUJXUPP-UHFFFAOYSA-N.
| Molecular formula | C14H8ClN3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzonitrile |
| InChIKey | AHKKVQQCUJXUPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CN3C=C(C=CC3=N2)Cl |
Computed by PubChem (NCBI)