CAS 481049-57-4 is the registry number for 3-(8-Chloroimidazo[1,2-a]pyridin-2-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(8-chloroimidazo[1,2-a]pyridin-2-yl)benzonitrile (CAS 481049-57-4) is a chemical compound with the molecular formula C14H8ClN3 and a molecular weight of 253.68 g/mol. IUPAC name: 3-(8-chloroimidazo[1,2-a]pyridin-2-yl)benzonitrile. InChIKey: GZMXSTJOPUKONT-UHFFFAOYSA-N.
| Molecular formula | C14H8ClN3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 3-(8-chloroimidazo[1,2-a]pyridin-2-yl)benzonitrile |
| InChIKey | GZMXSTJOPUKONT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CN3C=CC=C(C3=N2)Cl)C#N |
Computed by PubChem (NCBI)