CAS 1180493-12-2 appears in our catalog under these names: Sodium 3,4,5-trifluorobenzoate, 98%, 98%, 3,4,5-Trifluorobenzoic acid (sodium), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Sodium 3,4,5-trifluorobenzoate (CAS 1180493-12-2) is a chemical compound with the molecular formula C7H2F3NaO2 and a molecular weight of 198.07 g/mol. IUPAC name: sodium 3,4,5-trifluorobenzoate. InChIKey: XPRCJPTUIFMBBZ-UHFFFAOYSA-M.
| Molecular formula | C7H2F3NaO2 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | sodium 3,4,5-trifluorobenzoate |
| InChIKey | XPRCJPTUIFMBBZ-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)