CAS 1803845-07-9 is the registry number for 2,3,6-Trifluorobenzoic acid sodium salt, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Sodium 2,3,6-trifluorobenzoate (CAS 1803845-07-9) is a chemical compound with the molecular formula C7H2F3NaO2 and a molecular weight of 198.07 g/mol. IUPAC name: sodium 2,3,6-trifluorobenzoate. InChIKey: FACZAUDDGWDKQR-UHFFFAOYSA-M.
| Molecular formula | C7H2F3NaO2 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | sodium 2,3,6-trifluorobenzoate |
| InChIKey | FACZAUDDGWDKQR-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C(=C1F)C(=O)[O-])F)F.[Na+] |
Computed by PubChem (NCBI)