Products 118125-42-1

CAS 118125-42-1 is the registry number for (2-Oxo-1,3-oxazolidin-5-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(2-oxo-1,3-oxazolidin-5-yl)acetic acid (CAS 118125-42-1) is a chemical compound with the molecular formula C5H7NO4 and a molecular weight of 145.11 g/mol. IUPAC name: 2-(2-oxo-1,3-oxazolidin-5-yl)acetic acid. InChIKey: MTZFESAXMFTYQB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7NO4
Molecular weight145.11 g/mol
IUPAC name2-(2-oxo-1,3-oxazolidin-5-yl)acetic acid
InChIKeyMTZFESAXMFTYQB-UHFFFAOYSA-N
SMILESC1C(OC(=O)N1)CC(=O)O

Computed by PubChem (NCBI)