CAS 98302-45-5 is the registry number for (4S,5S)-5-Methyl-2-oxooxazolidine-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,5S)-5-methyl-2-oxo-1,3-oxazolidine-4-carboxylic acid (CAS 98302-45-5) is a chemical compound with the molecular formula C5H7NO4 and a molecular weight of 145.11 g/mol. IUPAC name: (4S,5S)-5-methyl-2-oxo-1,3-oxazolidine-4-carboxylic acid. InChIKey: KYNKAUUXUQOZSQ-HRFVKAFMSA-N.
| Molecular formula | C5H7NO4 |
|---|---|
| Molecular weight | 145.11 g/mol |
| IUPAC name | (4S,5S)-5-methyl-2-oxo-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | KYNKAUUXUQOZSQ-HRFVKAFMSA-N |
| SMILES | C[C@H]1[C@H](NC(=O)O1)C(=O)O |
Computed by PubChem (NCBI)