CAS 1181266-74-9 appears in our catalog under these names: 4-(4-Fluoro-benzyl)-benzoic acid, 95%, 4-(4-FLUORO-BENZYL)-BENZOIC ACID, 95+%, 95+%, 4-(4-FLUORO-BENZYL)-BENZOIC ACID, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-[(4-fluorophenyl)methyl]benzoic acid (CAS 1181266-74-9) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 4-[(4-fluorophenyl)methyl]benzoic acid. InChIKey: UEFFUEDUQCZWMV-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)methyl]benzoic acid |
| InChIKey | UEFFUEDUQCZWMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)