Products 1181309-02-3

CAS 1181309-02-3 is the registry number for 2-(Benzyloxy)-6-bromo-3-methoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-bromo-3-methoxy-2-phenylmethoxybenzoic acid (CAS 1181309-02-3) is a chemical compound with the molecular formula C15H13BrO4 and a molecular weight of 337.16 g/mol. IUPAC name: 6-bromo-3-methoxy-2-phenylmethoxybenzoic acid. InChIKey: AZCZKKIUXVKXFC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13BrO4
Molecular weight337.16 g/mol
IUPAC name6-bromo-3-methoxy-2-phenylmethoxybenzoic acid
InChIKeyAZCZKKIUXVKXFC-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)Br)C(=O)O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)