Products 214848-02-9

CAS 214848-02-9 is the registry number for 2-Bromo-5-methoxy-4-(phenylmethoxy)benzoic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

2-bromo-5-methoxy-4-phenylmethoxybenzoic acid (CAS 214848-02-9) is a chemical compound with the molecular formula C15H13BrO4 and a molecular weight of 337.16 g/mol. IUPAC name: 2-bromo-5-methoxy-4-phenylmethoxybenzoic acid. InChIKey: VWPRCDKRKCGEAK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13BrO4
Molecular weight337.16 g/mol
IUPAC name2-bromo-5-methoxy-4-phenylmethoxybenzoic acid
InChIKeyVWPRCDKRKCGEAK-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)O)Br)OCC2=CC=CC=C2

Computed by PubChem (NCBI)