CAS 1181353-33-2 appears in our catalog under these names: 2-Cyclohexyl-1,3-benzoxazole-6-carboxylic acid, 2-Cyclohexyl-1,3-benzoxazole-6-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
2-cyclohexyl-1,3-benzoxazole-6-carboxylic acid (CAS 1181353-33-2) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: 2-cyclohexyl-1,3-benzoxazole-6-carboxylic acid. InChIKey: SLTOJZPUDOLWKT-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 2-cyclohexyl-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | SLTOJZPUDOLWKT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC3=C(O2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)