CAS 1181457-71-5 is the registry number for 2-(4-Chlorophenyl)-4-(propane-1-sulfonyl)-1H-indol-6-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4-chlorophenyl)-4-propylsulfonyl-1H-indol-6-amine;hydrochloride (CAS 1181457-71-5) is a chemical compound with the molecular formula C17H18Cl2N2O2S and a molecular weight of 385.3 g/mol. IUPAC name: 2-(4-chlorophenyl)-4-propylsulfonyl-1H-indol-6-amine;hydrochloride. InChIKey: BVAXTPUNHDCOMP-UHFFFAOYSA-N.
| Molecular formula | C17H18Cl2N2O2S |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4-propylsulfonyl-1H-indol-6-amine;hydrochloride |
| InChIKey | BVAXTPUNHDCOMP-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)C1=CC(=CC2=C1C=C(N2)C3=CC=C(C=C3)Cl)N.Cl |
Computed by PubChem (NCBI)