CAS 312282-17-0 is the registry number for 1,4-dichloro-2-((4-benzylpiperazinyl)sulfonyl)benzene. Offered by: Biosynth. Available pack sizes: 250mg.
1-benzyl-4-(2,5-dichlorophenyl)sulfonylpiperazine (CAS 312282-17-0) is a chemical compound with the molecular formula C17H18Cl2N2O2S and a molecular weight of 385.3 g/mol. IUPAC name: 1-benzyl-4-(2,5-dichlorophenyl)sulfonylpiperazine. InChIKey: XYUDBWDVIFXSAG-UHFFFAOYSA-N.
| Molecular formula | C17H18Cl2N2O2S |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | 1-benzyl-4-(2,5-dichlorophenyl)sulfonylpiperazine |
| InChIKey | XYUDBWDVIFXSAG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)S(=O)(=O)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)