CAS 1181458-46-7 appears in our catalog under these names: 6-Ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine hydrochloride, 95%, 6-Ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine hydrochloride, 98%, 98%, 6-Ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride (CAS 1181458-46-7) is a chemical compound with the molecular formula C9H15ClN2S and a molecular weight of 218.75 g/mol. IUPAC name: 6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride. InChIKey: WBACAUGJHGDOTP-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2S |
|---|---|
| Molecular weight | 218.75 g/mol |
| IUPAC name | 6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride |
| InChIKey | WBACAUGJHGDOTP-UHFFFAOYSA-N |
| SMILES | CCC1CCC2=C(C1)SC(=N2)N.Cl |
Computed by PubChem (NCBI)