CAS 1311318-41-8 is the registry number for 1-(4-Methyl-1,3-thiazol-2-yl)cyclopentan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-methyl-1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride (CAS 1311318-41-8) is a chemical compound with the molecular formula C9H15ClN2S and a molecular weight of 218.75 g/mol. IUPAC name: 1-(4-methyl-1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride. InChIKey: XLFWLECSFKASFR-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2S |
|---|---|
| Molecular weight | 218.75 g/mol |
| IUPAC name | 1-(4-methyl-1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride |
| InChIKey | XLFWLECSFKASFR-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2(CCCC2)N.Cl |
Computed by PubChem (NCBI)