CAS 118218-19-2 is the registry number for Sodium 2-methoxybenzenesulfonate 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Sodium 2-methoxybenzenesulfonate (CAS 118218-19-2) is a chemical compound with the molecular formula C7H7NaO4S and a molecular weight of 210.18 g/mol. IUPAC name: sodium 2-methoxybenzenesulfonate. InChIKey: GYFOQWMHJBXAEQ-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO4S |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | sodium 2-methoxybenzenesulfonate |
| InChIKey | GYFOQWMHJBXAEQ-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC=C1S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)