CAS 73506-14-6 is the registry number for Sodium 4-(hydroxymethyl)benzene-1-sulfonate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Sodium 4-(hydroxymethyl)benzenesulfonate (CAS 73506-14-6) is a chemical compound with the molecular formula C7H7NaO4S and a molecular weight of 210.18 g/mol. IUPAC name: sodium 4-(hydroxymethyl)benzenesulfonate. InChIKey: GTNNBUGYJYIQGZ-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO4S |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | sodium 4-(hydroxymethyl)benzenesulfonate |
| InChIKey | GTNNBUGYJYIQGZ-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1CO)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)