CAS 1182349-06-9 is the registry number for 1-(4-Bromo-1H-indol-3-yl)-2,2,2-trichloroethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-1H-indol-3-yl)-2,2,2-trichloroethanone (CAS 1182349-06-9) is a chemical compound with the molecular formula C10H5BrCl3NO and a molecular weight of 341.4 g/mol. IUPAC name: 1-(4-bromo-1H-indol-3-yl)-2,2,2-trichloroethanone. InChIKey: PRSVXXZKFFNSQA-UHFFFAOYSA-N.
| Molecular formula | C10H5BrCl3NO |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 1-(4-bromo-1H-indol-3-yl)-2,2,2-trichloroethanone |
| InChIKey | PRSVXXZKFFNSQA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)