CAS 1820607-25-7 is the registry number for 1-(5-Bromo-1H-indol-2-yl)-2,2,2-trichloroethanone, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(5-bromo-1H-indol-2-yl)-2,2,2-trichloroethanone (CAS 1820607-25-7) is a chemical compound with the molecular formula C10H5BrCl3NO and a molecular weight of 341.4 g/mol. IUPAC name: 1-(5-bromo-1H-indol-2-yl)-2,2,2-trichloroethanone. InChIKey: PNMFANFTKZAXNQ-UHFFFAOYSA-N.
| Molecular formula | C10H5BrCl3NO |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 1-(5-bromo-1H-indol-2-yl)-2,2,2-trichloroethanone |
| InChIKey | PNMFANFTKZAXNQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(N2)C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)