CAS 1182434-75-8 appears in our catalog under these names: 2'-(2-Thienylidene)-4-chloroacetophenone, 95%, 2'-(2-Thienylidene)-4-chloroacetophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
1-(4-chlorophenyl)-2-thiophen-2-ylethanone (CAS 1182434-75-8) is a chemical compound with the molecular formula C12H9ClOS and a molecular weight of 236.72 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-thiophen-2-ylethanone. InChIKey: SDDXYPOTNAUZGU-UHFFFAOYSA-N.
| Molecular formula | C12H9ClOS |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-thiophen-2-ylethanone |
| InChIKey | SDDXYPOTNAUZGU-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)