CAS 51335-90-1 appears in our catalog under these names: 1-(5-(4-Chlorophenyl)-2-thienyl)-1-ethanone, 1-[5-(4-Chlorophenyl)-2-thienyl]-1-ethanone, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 1g, 10g.
1-[5-(4-chlorophenyl)thiophen-2-yl]ethanone (CAS 51335-90-1) is a chemical compound with the molecular formula C12H9ClOS and a molecular weight of 236.72 g/mol. IUPAC name: 1-[5-(4-chlorophenyl)thiophen-2-yl]ethanone. InChIKey: HVTLXJWEZWEMHB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClOS |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 1-[5-(4-chlorophenyl)thiophen-2-yl]ethanone |
| InChIKey | HVTLXJWEZWEMHB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(S1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)