CAS 1182783-55-6 is the registry number for 1–Benzyl–2–phenyl–1H–indazol–3(2H)–one. Offered by: GLPBio. Available pack sizes: 10mg.
1-benzyl-2-phenylindazol-3-one (CAS 1182783-55-6) is a chemical compound with the molecular formula C20H16N2O and a molecular weight of 300.4 g/mol. IUPAC name: 1-benzyl-2-phenylindazol-3-one. InChIKey: WISZIYPRRZFMBI-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 1-benzyl-2-phenylindazol-3-one |
| InChIKey | WISZIYPRRZFMBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=O)N2C4=CC=CC=C4 |
Computed by PubChem (NCBI)