CAS 452326-39-5 is the registry number for 2-([1,1'-Biphenyl]-4-yl)-2,3-dihydroquinazolin-4(1H)-one 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(4-phenylphenyl)-2,3-dihydro-1H-quinazolin-4-one (CAS 452326-39-5) is a chemical compound with the molecular formula C20H16N2O and a molecular weight of 300.4 g/mol. IUPAC name: 2-(4-phenylphenyl)-2,3-dihydro-1H-quinazolin-4-one. InChIKey: XRUAOBKXCFNPCK-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 2-(4-phenylphenyl)-2,3-dihydro-1H-quinazolin-4-one |
| InChIKey | XRUAOBKXCFNPCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3NC4=CC=CC=C4C(=O)N3 |
Computed by PubChem (NCBI)