Products 1182889-37-7
CAS 1182889-37-7 is the registry number for 2-Amino-2-(3,4-dimethylphenyl)propan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-2-(3,4-dimethylphenyl)propan-1-ol (CAS 1182889-37-7) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: 2-amino-2-(3,4-dimethylphenyl)propan-1-ol. InChIKey: BHCZJYXQRPDUPF-UHFFFAOYSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | 2-amino-2-(3,4-dimethylphenyl)propan-1-ol |
| InChIKey | BHCZJYXQRPDUPF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(CO)N)C |
Computed by PubChem (NCBI)