Products 1182910-54-8
CAS 1182910-54-8 is the registry number for 5-Chloro-3-(4-(trifluoromethoxy)phenyl)-1,2,4-oxadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole (CAS 1182910-54-8) is a chemical compound with the molecular formula C9H4ClF3N2O2 and a molecular weight of 264.59 g/mol. IUPAC name: 5-chloro-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole. InChIKey: FBFPPGLOIIHXLB-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF3N2O2 |
|---|---|
| Molecular weight | 264.59 g/mol |
| IUPAC name | 5-chloro-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole |
| InChIKey | FBFPPGLOIIHXLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)