Products 827042-61-5

CAS 827042-61-5 is the registry number for 5-Chloro-6-(trifluoromethyl)-1H-benzo[d]imidazole-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-chloro-6-(trifluoromethyl)-1H-benzimidazole-2-carboxylic acid (CAS 827042-61-5) is a chemical compound with the molecular formula C9H4ClF3N2O2 and a molecular weight of 264.59 g/mol. IUPAC name: 5-chloro-6-(trifluoromethyl)-1H-benzimidazole-2-carboxylic acid. InChIKey: DNLIWRZMQYWBRA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4ClF3N2O2
Molecular weight264.59 g/mol
IUPAC name5-chloro-6-(trifluoromethyl)-1H-benzimidazole-2-carboxylic acid
InChIKeyDNLIWRZMQYWBRA-UHFFFAOYSA-N
SMILESC1=C(C(=CC2=C1NC(=N2)C(=O)O)Cl)C(F)(F)F

Computed by PubChem (NCBI)