CAS 1182926-20-0 is the registry number for 5-(2,4,6-Trifluorophenyl)thiazol-2-amine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-(2,4,6-trifluorophenyl)-1,3-thiazol-2-amine (CAS 1182926-20-0) is a chemical compound with the molecular formula C9H5F3N2S and a molecular weight of 230.21 g/mol. IUPAC name: 5-(2,4,6-trifluorophenyl)-1,3-thiazol-2-amine. InChIKey: FWNAIQSTBCLCMI-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2S |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | 5-(2,4,6-trifluorophenyl)-1,3-thiazol-2-amine |
| InChIKey | FWNAIQSTBCLCMI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C2=CN=C(S2)N)F)F |
Computed by PubChem (NCBI)