CAS 35982-23-1 appears in our catalog under these names: 2-(Trifluoromethyl)quinazoline-4-thiol, 95%, 2-(Trifluoromethyl)quinazoline-4-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
2-(trifluoromethyl)-1H-quinazoline-4-thione (CAS 35982-23-1) is a chemical compound with the molecular formula C9H5F3N2S and a molecular weight of 230.21 g/mol. IUPAC name: 2-(trifluoromethyl)-1H-quinazoline-4-thione. InChIKey: HEZGELKZXNHIEP-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2S |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1H-quinazoline-4-thione |
| InChIKey | HEZGELKZXNHIEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=S)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)