CAS 1182991-43-0 appears in our catalog under these names: 5,8-Difluoro-2,3-dimethyl-1,4-dihydroquinolin-4-one, 95%, 5,8-Difluoro-2,3-dimethylquinolin-4(1h)-one, 98%, 5,8-Difluoro-2,3-dimethyl-1,4-dihydroquinolin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5,8-difluoro-2,3-dimethyl-1H-quinolin-4-one (CAS 1182991-43-0) is a chemical compound with the molecular formula C11H9F2NO and a molecular weight of 209.19 g/mol. IUPAC name: 5,8-difluoro-2,3-dimethyl-1H-quinolin-4-one. InChIKey: YWABXIOQUMMYFY-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO |
|---|---|
| Molecular weight | 209.19 g/mol |
| IUPAC name | 5,8-difluoro-2,3-dimethyl-1H-quinolin-4-one |
| InChIKey | YWABXIOQUMMYFY-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C(C=CC(=C2C1=O)F)F)C |
Computed by PubChem (NCBI)