CAS 1314778-62-5 is the registry number for 1-(3-(Difluoromethoxy)phenyl)cyclopropane-1-carbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-[3-(difluoromethoxy)phenyl]cyclopropane-1-carbonitrile (CAS 1314778-62-5) is a chemical compound with the molecular formula C11H9F2NO and a molecular weight of 209.19 g/mol. IUPAC name: 1-[3-(difluoromethoxy)phenyl]cyclopropane-1-carbonitrile. InChIKey: CRKMFXIEPRZBIB-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO |
|---|---|
| Molecular weight | 209.19 g/mol |
| IUPAC name | 1-[3-(difluoromethoxy)phenyl]cyclopropane-1-carbonitrile |
| InChIKey | CRKMFXIEPRZBIB-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C2=CC(=CC=C2)OC(F)F |
Computed by PubChem (NCBI)