CAS 1182992-21-7 appears in our catalog under these names: 1-(4-(4-Bromo-1H-pyrazol-1-yl)phenyl)ethanone, 97%, 1-(4-(4-Bromo-1H-pyrazol-1-yl)phenyl)ethanone, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-[4-(4-bromopyrazol-1-yl)phenyl]ethanone (CAS 1182992-21-7) is a chemical compound with the molecular formula C11H9BrN2O and a molecular weight of 265.11 g/mol. IUPAC name: 1-[4-(4-bromopyrazol-1-yl)phenyl]ethanone. InChIKey: SMTMWYLPTNOOAD-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | 1-[4-(4-bromopyrazol-1-yl)phenyl]ethanone |
| InChIKey | SMTMWYLPTNOOAD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2C=C(C=N2)Br |
Computed by PubChem (NCBI)