CAS 1183075-90-2 appears in our catalog under these names: 1,2-Bis(3-fluorophenyl)ethan-1-amine, 95%, 1,2-Bis(3-fluorophenyl)ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1,2-bis(3-fluorophenyl)ethanamine (CAS 1183075-90-2) is a chemical compound with the molecular formula C14H13F2N and a molecular weight of 233.26 g/mol. IUPAC name: 1,2-bis(3-fluorophenyl)ethanamine. InChIKey: QVJRANSSXJFNAZ-UHFFFAOYSA-N.
| Molecular formula | C14H13F2N |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 1,2-bis(3-fluorophenyl)ethanamine |
| InChIKey | QVJRANSSXJFNAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(C2=CC(=CC=C2)F)N |
Computed by PubChem (NCBI)