Products 1183123-01-4

CAS 1183123-01-4 is the registry number for tert-Butyl 2-((2,2,2-trifluoroethyl)amino)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(2,2,2-trifluoroethylamino)acetate (CAS 1183123-01-4) is a chemical compound with the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. IUPAC name: tert-butyl 2-(2,2,2-trifluoroethylamino)acetate. InChIKey: SRTAWWMBAQECIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14F3NO2
Molecular weight213.20 g/mol
IUPAC nametert-butyl 2-(2,2,2-trifluoroethylamino)acetate
InChIKeySRTAWWMBAQECIZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CNCC(F)(F)F

Computed by PubChem (NCBI)