Products 1384428-84-5

CAS 1384428-84-5 is the registry number for tert-Butyl N-(3,3,3-trifluoropropyl)carbamate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3,3,3-trifluoropropyl)carbamate (CAS 1384428-84-5) is a chemical compound with the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. IUPAC name: tert-butyl N-(3,3,3-trifluoropropyl)carbamate. InChIKey: GCJVFCJZMWUURS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14F3NO2
Molecular weight213.20 g/mol
IUPAC nametert-butyl N-(3,3,3-trifluoropropyl)carbamate
InChIKeyGCJVFCJZMWUURS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCC(F)(F)F

Computed by PubChem (NCBI)