Products 1183641-87-3

CAS 1183641-87-3 is the registry number for 2-Fluoro-5-(4-methylphenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-5-(4-methylphenyl)benzoic acid (CAS 1183641-87-3) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 2-fluoro-5-(4-methylphenyl)benzoic acid. InChIKey: IYTVYDHFZDUNIM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11FO2
Molecular weight230.23 g/mol
IUPAC name2-fluoro-5-(4-methylphenyl)benzoic acid
InChIKeyIYTVYDHFZDUNIM-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=CC(=C(C=C2)F)C(=O)O

Computed by PubChem (NCBI)