Products 1183979-76-1
CAS 1183979-76-1 is the registry number for 2-(3,5-Dimethylphenoxy)-6-fluoroaniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,5-dimethylphenoxy)-6-fluoroaniline (CAS 1183979-76-1) is a chemical compound with the molecular formula C14H14FNO and a molecular weight of 231.26 g/mol. IUPAC name: 2-(3,5-dimethylphenoxy)-6-fluoroaniline. InChIKey: XWQZUKJEAHZYRW-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO |
|---|---|
| Molecular weight | 231.26 g/mol |
| IUPAC name | 2-(3,5-dimethylphenoxy)-6-fluoroaniline |
| InChIKey | XWQZUKJEAHZYRW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC2=C(C(=CC=C2)F)N)C |
Computed by PubChem (NCBI)