CAS 118435-01-1 is the registry number for Benperidol N-Oxide (cis and trans). Offered by: Mikromol. Available pack sizes: 25mg.
3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-1-oxidopiperidin-1-ium-4-yl]-1H-benzimidazol-2-one (CAS 118435-01-1) is a chemical compound with the molecular formula C22H24FN3O3 and a molecular weight of 397.4 g/mol. IUPAC name: 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-1-oxidopiperidin-1-ium-4-yl]-1H-benzimidazol-2-one. InChIKey: YRAWEFKBIAYKNJ-UHFFFAOYSA-N.
| Molecular formula | C22H24FN3O3 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-1-oxidopiperidin-1-ium-4-yl]-1H-benzimidazol-2-one |
| InChIKey | YRAWEFKBIAYKNJ-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCC1N2C3=CC=CC=C3NC2=O)(CCCC(=O)C4=CC=C(C=C4)F)[O-] |
Computed by PubChem (NCBI)