Products 76330-73-9
CAS 76330-73-9 appears in our catalog under these names: Ketanserinol, 3-[2-[4-[(4-Fluorophenyl)hydroxymethyl]-1-piperidinyl]ethyl]-2,4(1H,3H)-quinazolinedione, 98%, 98%, Ketanserinol, 98.05%, Ketanserinol (Standard), Ketanserinol, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 100mg, 250mg, 10 mg, 25 mg, 50 mg, 100 mg, 5 mg.
3-[2-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione (CAS 76330-73-9) is a chemical compound with the molecular formula C22H24FN3O3 and a molecular weight of 397.4 g/mol. IUPAC name: 3-[2-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione. InChIKey: CSAITASUWRGAOT-UHFFFAOYSA-N.
| Molecular formula | C22H24FN3O3 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 3-[2-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione |
| InChIKey | CSAITASUWRGAOT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(C2=CC=C(C=C2)F)O)CCN3C(=O)C4=CC=CC=C4NC3=O |
Computed by PubChem (NCBI)