CAS 1184472-89-6 is the registry number for 2-(3,4-Difluorophenyl)-1H-imidazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(3,4-difluorophenyl)-1H-imidazole (CAS 1184472-89-6) is a chemical compound with the molecular formula C9H6F2N2 and a molecular weight of 180.15 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-1H-imidazole. InChIKey: MAWVUWSQZYBXBX-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2 |
|---|---|
| Molecular weight | 180.15 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-1H-imidazole |
| InChIKey | MAWVUWSQZYBXBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC=CN2)F)F |
Computed by PubChem (NCBI)