CAS 1184473-63-9 is the registry number for 2-(3,4-Dichlorophenyl)-2-{(2-(dimethylamino)ethyl)amino}acetonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetonitrile (CAS 1184473-63-9) is a chemical compound with the molecular formula C12H15Cl2N3 and a molecular weight of 272.17 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetonitrile. InChIKey: QWWVOZVNKLOSJU-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3 |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethylamino]acetonitrile |
| InChIKey | QWWVOZVNKLOSJU-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(C#N)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)