CAS 1187930-50-2 appears in our catalog under these names: 2-(4-Phenylpyrimidin-2-yl)ethylaminedihydrochloride, 97%, [2-(4-Phenyl-2-pyrimidinyl)ethyl]amine dihydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4-phenylpyrimidin-2-yl)ethanamine;dihydrochloride (CAS 1187930-50-2) is a chemical compound with the molecular formula C12H15Cl2N3 and a molecular weight of 272.17 g/mol. IUPAC name: 2-(4-phenylpyrimidin-2-yl)ethanamine;dihydrochloride. InChIKey: KIJJUWWEGPOYEI-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3 |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | 2-(4-phenylpyrimidin-2-yl)ethanamine;dihydrochloride |
| InChIKey | KIJJUWWEGPOYEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC=C2)CCN.Cl.Cl |
Computed by PubChem (NCBI)