Products 1184498-64-3
CAS 1184498-64-3 is the registry number for Methyl 4-chloro-2-((2-hydroxypropyl)amino)thiazole-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-chloro-2-(2-hydroxypropylamino)-1,3-thiazole-5-carboxylate (CAS 1184498-64-3) is a chemical compound with the molecular formula C8H11ClN2O3S and a molecular weight of 250.70 g/mol. IUPAC name: methyl 4-chloro-2-(2-hydroxypropylamino)-1,3-thiazole-5-carboxylate. InChIKey: OREHYTPTDGJZCO-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3S |
|---|---|
| Molecular weight | 250.70 g/mol |
| IUPAC name | methyl 4-chloro-2-(2-hydroxypropylamino)-1,3-thiazole-5-carboxylate |
| InChIKey | OREHYTPTDGJZCO-UHFFFAOYSA-N |
| SMILES | CC(CNC1=NC(=C(S1)C(=O)OC)Cl)O |
Computed by PubChem (NCBI)