CAS 1798747-14-4 is the registry number for Ethyl 5-acetyl-2-amino-1,3-thiazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Ethyl 5-acetyl-2-amino-1,3-thiazole-4-carboxylate;hydrochloride (CAS 1798747-14-4) is a chemical compound with the molecular formula C8H11ClN2O3S and a molecular weight of 250.70 g/mol. IUPAC name: ethyl 5-acetyl-2-amino-1,3-thiazole-4-carboxylate;hydrochloride. InChIKey: FLZBVTFEKISSEW-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3S |
|---|---|
| Molecular weight | 250.70 g/mol |
| IUPAC name | ethyl 5-acetyl-2-amino-1,3-thiazole-4-carboxylate;hydrochloride |
| InChIKey | FLZBVTFEKISSEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)N)C(=O)C.Cl |
Computed by PubChem (NCBI)