CAS 1184580-00-4 is the registry number for (4-(3,5-Dimethylphenoxy)-3-methylphenyl)methanamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[4-(3,5-dimethylphenoxy)-3-methylphenyl]methanamine (CAS 1184580-00-4) is a chemical compound with the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. IUPAC name: [4-(3,5-dimethylphenoxy)-3-methylphenyl]methanamine. InChIKey: FXEHQYCWLHWWGQ-UHFFFAOYSA-N.
| Molecular formula | C16H19NO |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | [4-(3,5-dimethylphenoxy)-3-methylphenyl]methanamine |
| InChIKey | FXEHQYCWLHWWGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC2=C(C=C(C=C2)CN)C)C |
Computed by PubChem (NCBI)