CAS 1184581-58-5 appears in our catalog under these names: Tafamidis Impurity 2, Tafamidis Impurity 7, 4-((3,5-Dichlorobenzoyl)amino)-3-hydroxybenzoic Acid, 4-(3,5-Dichlorobenzamido)-3-hydroxybenzoic acid, 98%, 98%, 4-(3,5-Dichlorobenzamido)-3-hydroxybenzoic acid, 98%. Offered by: Chemat Brand, TRC, Chemat, Fluorochem. Available pack sizes: on request, 2,5g, 100mg, 250mg, 1g.
4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid (CAS 1184581-58-5) is a chemical compound with the molecular formula C14H9Cl2NO4 and a molecular weight of 326.1 g/mol. IUPAC name: 4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid. InChIKey: RGISOLFSSBPMSO-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO4 |
|---|---|
| Molecular weight | 326.1 g/mol |
| IUPAC name | 4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid |
| InChIKey | RGISOLFSSBPMSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)NC(=O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)