CAS 899299-08-2 is the registry number for 4-(3,4-Dichlorobenzamido)-2-hydroxybenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[(3,4-dichlorobenzoyl)amino]-2-hydroxybenzoic acid (CAS 899299-08-2) is a chemical compound with the molecular formula C14H9Cl2NO4 and a molecular weight of 326.1 g/mol. IUPAC name: 4-[(3,4-dichlorobenzoyl)amino]-2-hydroxybenzoic acid. InChIKey: XNBHUADALNBFGC-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO4 |
|---|---|
| Molecular weight | 326.1 g/mol |
| IUPAC name | 4-[(3,4-dichlorobenzoyl)amino]-2-hydroxybenzoic acid |
| InChIKey | XNBHUADALNBFGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NC2=CC(=C(C=C2)C(=O)O)O)Cl)Cl |
Computed by PubChem (NCBI)