Products 899299-08-2

CAS 899299-08-2 is the registry number for 4-(3,4-Dichlorobenzamido)-2-hydroxybenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-[(3,4-dichlorobenzoyl)amino]-2-hydroxybenzoic acid (CAS 899299-08-2) is a chemical compound with the molecular formula C14H9Cl2NO4 and a molecular weight of 326.1 g/mol. IUPAC name: 4-[(3,4-dichlorobenzoyl)amino]-2-hydroxybenzoic acid. InChIKey: XNBHUADALNBFGC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9Cl2NO4
Molecular weight326.1 g/mol
IUPAC name4-[(3,4-dichlorobenzoyl)amino]-2-hydroxybenzoic acid
InChIKeyXNBHUADALNBFGC-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)NC2=CC(=C(C=C2)C(=O)O)O)Cl)Cl

Computed by PubChem (NCBI)