CAS 1184643-06-8 appears in our catalog under these names: 6-(2-Chlorophenoxy)-2,3-dimethyl-1,4-dihydroquinolin-4-one, 95%, 6-(2-Chlorophenoxy)-2,3-dimethyl-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-(2-chlorophenoxy)-2,3-dimethyl-1H-quinolin-4-one (CAS 1184643-06-8) is a chemical compound with the molecular formula C17H14ClNO2 and a molecular weight of 299.7 g/mol. IUPAC name: 6-(2-chlorophenoxy)-2,3-dimethyl-1H-quinolin-4-one. InChIKey: KONMQGLHIQAIBE-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO2 |
|---|---|
| Molecular weight | 299.7 g/mol |
| IUPAC name | 6-(2-chlorophenoxy)-2,3-dimethyl-1H-quinolin-4-one |
| InChIKey | KONMQGLHIQAIBE-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C(C1=O)C=C(C=C2)OC3=CC=CC=C3Cl)C |
Computed by PubChem (NCBI)