Products 1184914-71-3
CAS 1184914-71-3 is the registry number for 6-Bromo-3-(1-methyl-1h-pyrazol-4-yl)quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-bromo-3-(1-methylpyrazol-4-yl)quinoline (CAS 1184914-71-3) is a chemical compound with the molecular formula C13H10BrN3 and a molecular weight of 288.14 g/mol. IUPAC name: 6-bromo-3-(1-methylpyrazol-4-yl)quinoline. InChIKey: LOCJBBZLDUXSGD-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 6-bromo-3-(1-methylpyrazol-4-yl)quinoline |
| InChIKey | LOCJBBZLDUXSGD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CN=C3C=CC(=CC3=C2)Br |
Computed by PubChem (NCBI)