Products 610255-38-4
CAS 610255-38-4 is the registry number for N-(4-Bromophenyl)-1H-benzo[d]imidazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-bromophenyl)-1H-benzimidazol-2-amine (CAS 610255-38-4) is a chemical compound with the molecular formula C13H10BrN3 and a molecular weight of 288.14 g/mol. IUPAC name: N-(4-bromophenyl)-1H-benzimidazol-2-amine. InChIKey: IJLFUKZUJNSCDH-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | N-(4-bromophenyl)-1H-benzimidazol-2-amine |
| InChIKey | IJLFUKZUJNSCDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)NC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)