CAS 1184917-32-5 is the registry number for 8-(3-Chloro-5-fluorobenzyl)-8-azaspiro[bicyclo[3.2.1]octane-3,2'-oxirane], 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
8-[(3-chloro-5-fluorophenyl)methyl]spiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane] (CAS 1184917-32-5) is a chemical compound with the molecular formula C15H17ClFNO and a molecular weight of 281.75 g/mol. IUPAC name: 8-[(3-chloro-5-fluorophenyl)methyl]spiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane]. InChIKey: QLASZAHTQYRIDH-UHFFFAOYSA-N.
| Molecular formula | C15H17ClFNO |
|---|---|
| Molecular weight | 281.75 g/mol |
| IUPAC name | 8-[(3-chloro-5-fluorophenyl)methyl]spiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane] |
| InChIKey | QLASZAHTQYRIDH-UHFFFAOYSA-N |
| SMILES | C1CC2CC3(CC1N2CC4=CC(=CC(=C4)Cl)F)CO3 |
Computed by PubChem (NCBI)