CAS 2137771-71-0 is the registry number for 2-(3-(Benzyloxy)-5-fluorophenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-fluoro-5-phenylmethoxyphenyl)ethanamine;hydrochloride (CAS 2137771-71-0) is a chemical compound with the molecular formula C15H17ClFNO and a molecular weight of 281.75 g/mol. IUPAC name: 2-(3-fluoro-5-phenylmethoxyphenyl)ethanamine;hydrochloride. InChIKey: LOOHZADKWRSROQ-UHFFFAOYSA-N.
| Molecular formula | C15H17ClFNO |
|---|---|
| Molecular weight | 281.75 g/mol |
| IUPAC name | 2-(3-fluoro-5-phenylmethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | LOOHZADKWRSROQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)CCN)F.Cl |
Computed by PubChem (NCBI)